C22H28F3N5O4S — CID 45110977
amino (2E)-2-[2-[(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)carbamoyl]-4-(trifluoromethyl)phenoxy]iminobutanoate (PubChem CID 45110977) has the molecular formula C22H28F3N5O4S and a molecular weight of 515.56 g/mol. Its IUPAC name is amino (2E)-2-[2-[(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)carbamoyl]-4-(trifluoromethyl)phenoxy]iminobutanoate.
| Compound Name | amino (2E)-2-[2-[(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)carbamoyl]-4-(trifluoromethyl)phenoxy]iminobutanoate |
|---|---|
| PubChem CID | 45110977 |
| Molecular Formula | C22H28F3N5O4S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | amino (2E)-2-[2-[(3-butyl-5-tert-butyl-1,3,4-thiadiazol-2-ylidene)carbamoyl]-4-(trifluoromethyl)phenoxy]iminobutanoate |
| SMILES | CCCCn1nc(C(C)(C)C)s/c1=N/C(=O)c1cc(C(F)(F)F)ccc1O/N=C(\CC)C(=O)ON |
| InChI | InChI=1S/C22H28F3N5O4S/c1-6-8-11-30-20(35-19(28-30)21(3,4)5)27-17(31)14-12-13(22(23,24)25)9-10-16(14)34-29-15(7-2)18(32)33-26/h9-10,12H,6-8,11,26H2,1-5H3/b27-20+,29-15+ |
| InChIKey | OHSGYQOBHOAKCX-KHTOFDOCSA-N |
| XLogP | 4.36 |
| TPSA | 121.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|