C13H17F3O5S — CID 45112845
methyl 6-methyl-6-propyl-5-(trifluoromethylsulfonyloxy)cyclohexa-1,4-diene-1-carboxylate (PubChem CID 45112845) has the molecular formula C13H17F3O5S and a molecular weight of 342.34 g/mol. Its IUPAC name is methyl 6-methyl-6-propyl-5-(trifluoromethylsulfonyloxy)cyclohexa-1,4-diene-1-carboxylate.
| Compound Name | methyl 6-methyl-6-propyl-5-(trifluoromethylsulfonyloxy)cyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 45112845 |
| Molecular Formula | C13H17F3O5S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl 6-methyl-6-propyl-5-(trifluoromethylsulfonyloxy)cyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCCC1(C)C(OS(=O)(=O)C(F)(F)F)=CCC=C1C(=O)OC |
| InChI | InChI=1S/C13H17F3O5S/c1-4-8-12(2)9(11(17)20-3)6-5-7-10(12)21-22(18,19)13(14,15)16/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | OYLLMKMLBZBPLM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|