C9H16N2O2 — CID 45119415
2-acetamido-N,N-diethylprop-2-enamide (PubChem CID 45119415) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-acetamido-N,N-diethylprop-2-enamide.
| Compound Name | 2-acetamido-N,N-diethylprop-2-enamide |
|---|---|
| PubChem CID | 45119415 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2-acetamido-N,N-diethylprop-2-enamide |
| SMILES | C=C(NC(C)=O)C(=O)N(CC)CC |
| InChI | InChI=1S/C9H16N2O2/c1-5-11(6-2)9(13)7(3)10-8(4)12/h3,5-6H2,1-2,4H3,(H,10,12) |
| InChIKey | HYYWVZCUNNBERG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|