C20H14FNO2 — CID 45119787
3-(4-fluorophenyl)-7-methyl-2-phenylfuro[2,3-b]pyridin-4-one (PubChem CID 45119787) has the molecular formula C20H14FNO2 and a molecular weight of 319.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-7-methyl-2-phenylfuro[2,3-b]pyridin-4-one.
| Compound Name | 3-(4-fluorophenyl)-7-methyl-2-phenylfuro[2,3-b]pyridin-4-one |
|---|---|
| PubChem CID | 45119787 |
| Molecular Formula | C20H14FNO2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-(4-fluorophenyl)-7-methyl-2-phenylfuro[2,3-b]pyridin-4-one |
| SMILES | Cn1ccc(=O)c2c(-c3ccc(F)cc3)c(-c3ccccc3)oc21 |
| InChI | InChI=1S/C20H14FNO2/c1-22-12-11-16(23)18-17(13-7-9-15(21)10-8-13)19(24-20(18)22)14-5-3-2-4-6-14/h2-12H,1H3 |
| InChIKey | VMZOFWCDFLANBA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |