C9H16O — CID 45120446
2,4-dimethyl-1-oxaspiro[2.5]octane (PubChem CID 45120446) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,4-dimethyl-1-oxaspiro[2.5]octane.
| Compound Name | 2,4-dimethyl-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 45120446 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 2,4-dimethyl-1-oxaspiro[2.5]octane |
| SMILES | CC1CCCCC12OC2C |
| InChI | InChI=1S/C9H16O/c1-7-5-3-4-6-9(7)8(2)10-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | ZNCBSKPVAIPBRN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|