C10H18OP+ — CID 6333537
3,3-dimethyl-2,3a,4,5,6,7-hexahydro-1aH-phosphindolo[3,3a-b]oxiren-3-ium (PubChem CID 6333537) has the molecular formula C10H18OP+ and a molecular weight of 185.23 g/mol. Its IUPAC name is 3,3-dimethyl-2,3a,4,5,6,7-hexahydro-1aH-phosphindolo[3,3a-b]oxiren-3-ium.
| Compound Name | 3,3-dimethyl-2,3a,4,5,6,7-hexahydro-1aH-phosphindolo[3,3a-b]oxiren-3-ium |
|---|---|
| PubChem CID | 6333537 |
| Molecular Formula | C10H18OP+ |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3,3-dimethyl-2,3a,4,5,6,7-hexahydro-1aH-phosphindolo[3,3a-b]oxiren-3-ium |
| SMILES | C[P+]1(C)CC2OC23CCCCC31 |
| InChI | InChI=1S/C10H18OP/c1-12(2)7-8-10(11-8)6-4-3-5-9(10)12/h8-9H,3-7H2,1-2H3/q+1 |
| InChIKey | YVSGGBQMRABAOF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|