C11H14N2 — CID 45120848
5-(1,2,3,4,5,6-hexahydropentalen-1-yl)-1H-imidazole (PubChem CID 45120848) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 5-(1,2,3,4,5,6-hexahydropentalen-1-yl)-1H-imidazole.
| Compound Name | 5-(1,2,3,4,5,6-hexahydropentalen-1-yl)-1H-imidazole |
|---|---|
| PubChem CID | 45120848 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 5-(1,2,3,4,5,6-hexahydropentalen-1-yl)-1H-imidazole |
| SMILES | c1ncc(C2CCC3=C2CCC3)[nH]1 |
| InChI | InChI=1S/C11H14N2/c1-2-8-4-5-10(9(8)3-1)11-6-12-7-13-11/h6-7,10H,1-5H2,(H,12,13) |
| InChIKey | GMOJQIPXFOCGMR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|