C14H13N3S — CID 10422502
5-(5-isothiocyanato-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole (PubChem CID 10422502) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is 5-(5-isothiocyanato-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole.
| Compound Name | 5-(5-isothiocyanato-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole |
|---|---|
| PubChem CID | 10422502 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-(5-isothiocyanato-1,2,3,4-tetrahydronaphthalen-1-yl)-1H-imidazole |
| SMILES | S=C=Nc1cccc2c1CCCC2c1cnc[nH]1 |
| InChI | InChI=1S/C14H13N3S/c18-9-17-13-6-2-3-10-11(13)4-1-5-12(10)14-7-15-8-16-14/h2-3,6-8,12H,1,4-5H2,(H,15,16) |
| InChIKey | YGJNLWNXWJCFJB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|