C20H18N4O6S2 — CID 45124744
2-[4-[(E)-[[2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 45124744) has the molecular formula C20H18N4O6S2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 2-[4-[(E)-[[2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[[2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 45124744 |
| Molecular Formula | C20H18N4O6S2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 2-[4-[(E)-[[2-(benzenesulfonamido)-4-methyl-1,3-thiazole-5-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1nc(NS(=O)(=O)c2ccccc2)sc1C(=O)N/N=C/c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C20H18N4O6S2/c1-13-18(31-20(22-13)24-32(28,29)16-5-3-2-4-6-16)19(27)23-21-11-14-7-9-15(10-8-14)30-12-17(25)26/h2-11H,12H2,1H3,(H,22,24)(H,23,27)(H,25,26)/b21-11+ |
| InChIKey | HCTAZZWNVDHFHG-SRZZPIQSSA-N |
| XLogP | 2.48 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|