C26H33N5O7S2 — CID 45124831
acetic acid;6-[(5Z)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 45124831) has the molecular formula C26H33N5O7S2 and a molecular weight of 591.71 g/mol. Its IUPAC name is acetic acid;6-[(5Z)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | acetic acid;6-[(5Z)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 45124831 |
| Molecular Formula | C26H33N5O7S2 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | acetic acid;6-[(5Z)-5-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CC(=O)O.O=C(O)CCCCCN1C(=O)/C(=C/c2c(N3CCN(CCO)CC3)nc3ccccn3c2=O)SC1=S |
| InChI | InChI=1S/C24H29N5O5S2.C2H4O2/c30-15-14-26-10-12-27(13-11-26)21-17(22(33)28-8-5-3-6-19(28)25-21)16-18-23(34)29(24(35)36-18)9-4-1-2-7-20(31)32;1-2(3)4/h3,5-6,8,16,30H,1-2,4,7,9-15H2,(H,31,32);1H3,(H,3,4)/b18-16-; |
| InChIKey | HODQHBDVJNNMDN-FTUZMNKQSA-N |
| XLogP | 1.75 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|