C19H20N2O4 — CID 45124852
N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3,4-dihydro-1H-isochromene-1-carboxamide (PubChem CID 45124852) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3,4-dihydro-1H-isochromene-1-carboxamide.
| Compound Name | N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3,4-dihydro-1H-isochromene-1-carboxamide |
|---|---|
| PubChem CID | 45124852 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]-3,4-dihydro-1H-isochromene-1-carboxamide |
| SMILES | COc1ccc(/C=N\NC(=O)C2OCCc3ccccc32)cc1OC |
| InChI | InChI=1S/C19H20N2O4/c1-23-16-8-7-13(11-17(16)24-2)12-20-21-19(22)18-15-6-4-3-5-14(15)9-10-25-18/h3-8,11-12,18H,9-10H2,1-2H3,(H,21,22)/b20-12- |
| InChIKey | DGLVCCOKRDMBRN-NDENLUEZSA-N |
| XLogP | 2.47 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|