C13H16O7S — CID 45126598
2-[(4-methoxyphenyl)methylsulfonyl]-2-methylbutanedioic acid (PubChem CID 45126598) has the molecular formula C13H16O7S and a molecular weight of 316.33 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylsulfonyl]-2-methylbutanedioic acid.
| Compound Name | 2-[(4-methoxyphenyl)methylsulfonyl]-2-methylbutanedioic acid |
|---|---|
| PubChem CID | 45126598 |
| Molecular Formula | C13H16O7S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylsulfonyl]-2-methylbutanedioic acid |
| SMILES | COc1ccc(CS(=O)(=O)C(C)(CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C13H16O7S/c1-13(12(16)17,7-11(14)15)21(18,19)8-9-3-5-10(20-2)6-4-9/h3-6H,7-8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | AGTOKOKXQMHKNC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |