C29H23BrN2O6S — CID 45128627
(4Z)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 45128627) has the molecular formula C29H23BrN2O6S and a molecular weight of 607.48 g/mol. Its IUPAC name is (4Z)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45128627 |
| Molecular Formula | C29H23BrN2O6S |
| Molecular Weight | 607.48 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | (4Z)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(/O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2nc3ccc(C)cc3s2)cc(Br)c1O |
| InChI | InChI=1S/C29H23BrN2O6S/c1-13-4-6-19-22(8-13)39-29(31-19)32-24(17-11-18(30)26(34)21(12-17)37-3)23(27(35)28(32)36)25(33)15-5-7-20-16(10-15)9-14(2)38-20/h4-8,10-12,14,24,33-34H,9H2,1-3H3/b25-23- |
| InChIKey | UXUCTMCKQMZBIH-BZZOAKBMSA-N |
| XLogP | 6.03 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|