C28H19FN6O4S2 — CID 45128650
(E)-2-cyano-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide (PubChem CID 45128650) has the molecular formula C28H19FN6O4S2 and a molecular weight of 586.63 g/mol. Its IUPAC name is (E)-2-cyano-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 45128650 |
| Molecular Formula | C28H19FN6O4S2 |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | (E)-2-cyano-N-[5-[(2-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-[2-(4-methoxyphenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enamide |
| SMILES | COc1ccc(Oc2nc3ccccn3c(=O)c2/C=C(\C#N)C(=O)Nc2nnc(SCc3ccccc3F)s2)cc1 |
| InChI | InChI=1S/C28H19FN6O4S2/c1-38-19-9-11-20(12-10-19)39-25-21(26(37)35-13-5-4-8-23(35)31-25)14-18(15-30)24(36)32-27-33-34-28(41-27)40-16-17-6-2-3-7-22(17)29/h2-14H,16H2,1H3,(H,32,33,36)/b18-14+ |
| InChIKey | HHEIMEHHAMLTGK-NBVRZTHBSA-N |
| XLogP | 5.32 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|