C18H13Cl4N3OS — CID 45128916
(5Z)-2-[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[(2,6-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 45128916) has the molecular formula C18H13Cl4N3OS and a molecular weight of 461.20 g/mol. Its IUPAC name is (5Z)-2-[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[(2,6-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5Z)-2-[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[(2,6-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 45128916 |
| Molecular Formula | C18H13Cl4N3OS |
| Molecular Weight | 461.20 g/mol |
| Exact Mass | 458.95 |
| IUPAC Name | (5Z)-2-[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[(2,6-dichlorophenyl)methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1c1nc2s/c(=C\c3c(Cl)cccc3Cl)c(=O)n2n1 |
| InChI | InChI=1S/C18H13Cl4N3OS/c1-18(2)9(7-13(21)22)14(18)15-23-17-25(24-15)16(26)12(27-17)6-8-10(19)4-3-5-11(8)20/h3-7,9,14H,1-2H3/b12-6- |
| InChIKey | VXIBCUGCSLNEHD-SDQBBNPISA-N |
| XLogP | 5.06 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |