C22H16Cl2N4O4S — CID 34315279
(5E)-2-[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 34315279) has the molecular formula C22H16Cl2N4O4S and a molecular weight of 503.37 g/mol. Its IUPAC name is (5E)-2-[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | (5E)-2-[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 34315279 |
| Molecular Formula | C22H16Cl2N4O4S |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | (5E)-2-[(1R,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]-5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CC1(C)[C@H](c2nc3s/c(=C/c4ccc(-c5ccccc5[N+](=O)[O-])o4)c(=O)n3n2)[C@@H]1C=C(Cl)Cl |
| InChI | InChI=1S/C22H16Cl2N4O4S/c1-22(2)13(10-17(23)24)18(22)19-25-21-27(26-19)20(29)16(33-21)9-11-7-8-15(32-11)12-5-3-4-6-14(12)28(30)31/h3-10,13,18H,1-2H3/b16-9+/t13-,18-/m0/s1 |
| InChIKey | NTKRVCDIDRYVEK-BFABYBEPSA-N |
| XLogP | 4.93 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|