C24H14N4O7S — CID 6521303
(7Z)-3-(1,3-benzodioxol-5-ylmethyl)-7-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione (PubChem CID 6521303) has the molecular formula C24H14N4O7S and a molecular weight of 502.46 g/mol. Its IUPAC name is (7Z)-3-(1,3-benzodioxol-5-ylmethyl)-7-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione.
| Compound Name | (7Z)-3-(1,3-benzodioxol-5-ylmethyl)-7-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 6521303 |
| Molecular Formula | C24H14N4O7S |
| Molecular Weight | 502.46 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | (7Z)-3-(1,3-benzodioxol-5-ylmethyl)-7-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione |
| SMILES | O=c1c(Cc2ccc3c(c2)OCO3)nnc2s/c(=C\c3ccc(-c4ccccc4[N+](=O)[O-])o3)c(=O)n12 |
| InChI | InChI=1S/C24H14N4O7S/c29-22-16(9-13-5-7-19-20(10-13)34-12-33-19)25-26-24-27(22)23(30)21(36-24)11-14-6-8-18(35-14)15-3-1-2-4-17(15)28(31)32/h1-8,10-11H,9,12H2/b21-11- |
| InChIKey | QZZJCWFYDTZGOC-NHDPSOOVSA-N |
| XLogP | 2.55 |
| TPSA | 139.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|