C23H12Cl3N3O3S — CID 11466475
(7Z)-7-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione (PubChem CID 11466475) has the molecular formula C23H12Cl3N3O3S and a molecular weight of 516.79 g/mol. Its IUPAC name is (7Z)-7-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione.
| Compound Name | (7Z)-7-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 11466475 |
| Molecular Formula | C23H12Cl3N3O3S |
| Molecular Weight | 516.79 g/mol |
| Exact Mass | 514.97 |
| IUPAC Name | (7Z)-7-[[5-(4-chlorophenyl)furan-2-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione |
| SMILES | O=c1c(Cc2ccc(Cl)cc2Cl)nnc2s/c(=C\c3ccc(-c4ccc(Cl)cc4)o3)c(=O)n12 |
| InChI | InChI=1S/C23H12Cl3N3O3S/c24-14-4-1-12(2-5-14)19-8-7-16(32-19)11-20-22(31)29-21(30)18(27-28-23(29)33-20)9-13-3-6-15(25)10-17(13)26/h1-8,10-11H,9H2/b20-11- |
| InChIKey | FZUAJOVHFFTTNF-JAIQZWGSSA-N |
| XLogP | 4.87 |
| TPSA | 77.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |