C20H11Cl2N3O4S — CID 46243329
(7Z)-7-(1,3-benzodioxol-5-ylmethylidene)-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione (PubChem CID 46243329) has the molecular formula C20H11Cl2N3O4S and a molecular weight of 460.30 g/mol. Its IUPAC name is (7Z)-7-(1,3-benzodioxol-5-ylmethylidene)-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione.
| Compound Name | (7Z)-7-(1,3-benzodioxol-5-ylmethylidene)-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 46243329 |
| Molecular Formula | C20H11Cl2N3O4S |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | (7Z)-7-(1,3-benzodioxol-5-ylmethylidene)-3-[(2,4-dichlorophenyl)methyl]-[1,3]thiazolo[2,3-c][1,2,4]triazine-4,6-dione |
| SMILES | O=c1c(Cc2ccc(Cl)cc2Cl)nnc2s/c(=C\c3ccc4c(c3)OCO4)c(=O)n12 |
| InChI | InChI=1S/C20H11Cl2N3O4S/c21-12-3-2-11(13(22)8-12)7-14-18(26)25-19(27)17(30-20(25)24-23-14)6-10-1-4-15-16(5-10)29-9-28-15/h1-6,8H,7,9H2/b17-6- |
| InChIKey | VRNQPCFPFWIZSL-FMQZQXMHSA-N |
| XLogP | 2.69 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |