C15H12N2O4S — CID 27235171
(2E,7S)-2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-6,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione (PubChem CID 27235171) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is (2E,7S)-2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-6,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione.
| Compound Name | (2E,7S)-2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-6,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione |
|---|---|
| PubChem CID | 27235171 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (2E,7S)-2-(1,3-benzodioxol-5-ylmethylidene)-7-methyl-6,7-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-3,5-dione |
| SMILES | C[C@H]1CC(=O)n2c(s/c(=C/c3ccc4c(c3)OCO4)c2=O)=N1 |
| InChI | InChI=1S/C15H12N2O4S/c1-8-4-13(18)17-14(19)12(22-15(17)16-8)6-9-2-3-10-11(5-9)21-7-20-10/h2-3,5-6,8H,4,7H2,1H3/b12-6+/t8-/m0/s1 |
| InChIKey | PLMBJFGIZSLEDQ-UGZWPXFQSA-N |
| XLogP | 0.52 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |