C26H22N4O5S — CID 5269256
5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one (PubChem CID 5269256) has the molecular formula C26H22N4O5S and a molecular weight of 502.55 g/mol. Its IUPAC name is 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one.
| Compound Name | 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
|---|---|
| PubChem CID | 5269256 |
| Molecular Formula | C26H22N4O5S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 5-[[5-(2-nitrophenyl)furan-2-yl]methylidene]-2-(4-pentoxyphenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-one |
| SMILES | CCCCCOc1ccc(-c2nc3sc(=Cc4ccc(-c5ccccc5[N+](=O)[O-])o4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C26H22N4O5S/c1-2-3-6-15-34-18-11-9-17(10-12-18)24-27-26-29(28-24)25(31)23(36-26)16-19-13-14-22(35-19)20-7-4-5-8-21(20)30(32)33/h4-5,7-14,16H,2-3,6,15H2,1H3 |
| InChIKey | IGSDZEDHECKDIH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|