C30H29N3O5S — CID 6318654
ethyl 4-[5-[(E)-[2-(4-hexoxyphenyl)-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 6318654) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-[2-(4-hexoxyphenyl)-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-[2-(4-hexoxyphenyl)-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6318654 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | ethyl 4-[5-[(E)-[2-(4-hexoxyphenyl)-6-oxo-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCCCCCOc1ccc(-c2nc3s/c(=C/c4ccc(-c5ccc(C(=O)OCC)cc5)o4)c(=O)n3n2)cc1 |
| InChI | InChI=1S/C30H29N3O5S/c1-3-5-6-7-18-37-23-14-12-21(13-15-23)27-31-30-33(32-27)28(34)26(39-30)19-24-16-17-25(38-24)20-8-10-22(11-9-20)29(35)36-4-2/h8-17,19H,3-7,18H2,1-2H3/b26-19+ |
| InChIKey | ZAJFHKCPIQOHMN-LGUFXXKBSA-N |
| XLogP | 5.76 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|