C16H21BrN4OS — CID 45129297
6-(4-methoxyphenyl)-3-pentyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide (PubChem CID 45129297) has the molecular formula C16H21BrN4OS and a molecular weight of 397.34 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3-pentyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide.
| Compound Name | 6-(4-methoxyphenyl)-3-pentyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide |
|---|---|
| PubChem CID | 45129297 |
| Molecular Formula | C16H21BrN4OS |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 6-(4-methoxyphenyl)-3-pentyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide |
| SMILES | Br.CCCCCc1nnc2n1N=C(c1ccc(OC)cc1)CS2 |
| InChI | InChI=1S/C16H20N4OS.BrH/c1-3-4-5-6-15-17-18-16-20(15)19-14(11-22-16)12-7-9-13(21-2)10-8-12;/h7-10H,3-6,11H2,1-2H3;1H |
| InChIKey | MBGBBTPNXOFYEU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|