C21H21F3N4O2 — CID 45141635
tert-butyl N-[(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-yl]carbamate (PubChem CID 45141635) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is tert-butyl N-[(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-yl]carbamate.
| Compound Name | tert-butyl N-[(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-yl]carbamate |
|---|---|
| PubChem CID | 45141635 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | tert-butyl N-[(11R,12R)-11-(2,4,5-trifluorophenyl)-1,5,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-12-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1Cn2c(nc3cnccc32)C[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H21F3N4O2/c1-21(2,3)30-20(29)27-17-10-28-18-4-5-25-9-16(18)26-19(28)7-12(17)11-6-14(23)15(24)8-13(11)22/h4-6,8-9,12,17H,7,10H2,1-3H3,(H,27,29)/t12-,17+/m1/s1 |
| InChIKey | ZJCZYHHXWSBINR-PXAZEXFGSA-N |
| XLogP | 4.08 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|