C17H17N3O7 — CID 45143448
2-[(4-methylbenzoyl)amino]-3-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethoxy]-3-oxopropanoic acid (PubChem CID 45143448) has the molecular formula C17H17N3O7 and a molecular weight of 375.34 g/mol. Its IUPAC name is 2-[(4-methylbenzoyl)amino]-3-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethoxy]-3-oxopropanoic acid.
| Compound Name | 2-[(4-methylbenzoyl)amino]-3-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 45143448 |
| Molecular Formula | C17H17N3O7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 2-[(4-methylbenzoyl)amino]-3-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethoxy]-3-oxopropanoic acid |
| SMILES | Cc1ccc(C(=O)NC(C(=O)O)C(=O)OCC(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C17H17N3O7/c1-9-3-5-11(6-4-9)15(22)19-14(16(23)24)17(25)26-8-13(21)18-12-7-10(2)27-20-12/h3-7,14H,8H2,1-2H3,(H,19,22)(H,23,24)(H,18,20,21) |
| InChIKey | OZAPELZCCRIYCM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|