C17H18N4O3 — CID 45146807
4-nitro-N-[(E)-1-(2,4,6-trimethyl-3-pyridinyl)ethylideneamino]benzamide (PubChem CID 45146807) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-nitro-N-[(E)-1-(2,4,6-trimethyl-3-pyridinyl)ethylideneamino]benzamide.
| Compound Name | 4-nitro-N-[(E)-1-(2,4,6-trimethyl-3-pyridinyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 45146807 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-nitro-N-[(E)-1-(2,4,6-trimethyl-3-pyridinyl)ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc([N+](=O)[O-])cc1)c1c(C)cc(C)nc1C |
| InChI | InChI=1S/C17H18N4O3/c1-10-9-11(2)18-12(3)16(10)13(4)19-20-17(22)14-5-7-15(8-6-14)21(23)24/h5-9H,1-4H3,(H,20,22)/b19-13+ |
| InChIKey | BSGZOCHMTVSTQH-CPNJWEJPSA-N |
| XLogP | 3.07 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|