C27H27N3O2 — CID 45146926
N-[(E)-[1-[2-(2,5-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]benzamide (PubChem CID 45146926) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(E)-[1-[2-(2,5-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[1-[2-(2,5-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 45146926 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-[(E)-[1-[2-(2,5-dimethylphenoxy)ethyl]-2-methylindol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(C)c(OCCn2c(C)c(/C=N/NC(=O)c3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C27H27N3O2/c1-19-13-14-20(2)26(17-19)32-16-15-30-21(3)24(23-11-7-8-12-25(23)30)18-28-29-27(31)22-9-5-4-6-10-22/h4-14,17-18H,15-16H2,1-3H3,(H,29,31)/b28-18+ |
| InChIKey | MHWALCUQYPSEEK-MTDXEUNCSA-N |
| XLogP | 5.41 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|