C21H23ClN2O3 — CID 45146956
[2-[(5-chloro-2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-3-yl]-morpholin-4-ylmethanone (PubChem CID 45146956) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is [2-[(5-chloro-2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[(5-chloro-2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 45146956 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [2-[(5-chloro-2-hydroxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1Cc2ccccc2CN1Cc1cc(Cl)ccc1O)N1CCOCC1 |
| InChI | InChI=1S/C21H23ClN2O3/c22-18-5-6-20(25)17(11-18)14-24-13-16-4-2-1-3-15(16)12-19(24)21(26)23-7-9-27-10-8-23/h1-6,11,19,25H,7-10,12-14H2 |
| InChIKey | GDSMCRLZZDZTSW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|