C7H11N5O3S — CID 45148250
N-(1,1-dioxothiolan-3-yl)-2-(tetrazol-1-yl)acetamide (PubChem CID 45148250) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 45148250 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H11N5O3S/c13-7(3-12-5-8-10-11-12)9-6-1-2-16(14,15)4-6/h5-6H,1-4H2,(H,9,13) |
| InChIKey | HECNVHNAUYERFJ-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |