C5H10N6O3S — CID 61130292
N-(2-sulfamoylethyl)-2-(tetrazol-1-yl)acetamide (PubChem CID 61130292) has the molecular formula C5H10N6O3S and a molecular weight of 234.24 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-(2-sulfamoylethyl)-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 61130292 |
| Molecular Formula | C5H10N6O3S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-(2-sulfamoylethyl)-2-(tetrazol-1-yl)acetamide |
| SMILES | NS(=O)(=O)CCNC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C5H10N6O3S/c6-15(13,14)2-1-7-5(12)3-11-4-8-9-10-11/h4H,1-3H2,(H,7,12)(H2,6,13,14) |
| InChIKey | FHNVFUWYEOBVTI-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |