C7H13N5O3S — CID 61132734
N-(3-sulfamoylpropyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 61132734) has the molecular formula C7H13N5O3S and a molecular weight of 247.28 g/mol. Its IUPAC name is N-(3-sulfamoylpropyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(3-sulfamoylpropyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 61132734 |
| Molecular Formula | C7H13N5O3S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-(3-sulfamoylpropyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | NS(=O)(=O)CCCNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C7H13N5O3S/c8-16(14,15)3-1-2-10-7(13)4-12-6-9-5-11-12/h5-6H,1-4H2,(H,10,13)(H2,8,14,15) |
| InChIKey | CXXAQFZHLKZLPL-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|