C6H11N5O3S — CID 61066852
N-(2-sulfamoylethyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 61066852) has the molecular formula C6H11N5O3S and a molecular weight of 233.25 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(2-sulfamoylethyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 61066852 |
| Molecular Formula | C6H11N5O3S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | N-(2-sulfamoylethyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | NS(=O)(=O)CCNC(=O)Cn1cncn1 |
| InChI | InChI=1S/C6H11N5O3S/c7-15(13,14)2-1-9-6(12)3-11-5-8-4-10-11/h4-5H,1-3H2,(H,9,12)(H2,7,13,14) |
| InChIKey | VGFIECZBIMGFNW-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |