C8H13N5O2 — CID 45148255
N-(oxolan-2-ylmethyl)-2-(tetrazol-1-yl)acetamide (PubChem CID 45148255) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-2-(tetrazol-1-yl)acetamide.
| Compound Name | N-(oxolan-2-ylmethyl)-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 45148255 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cnnn1)NCC1CCCO1 |
| InChI | InChI=1S/C8H13N5O2/c14-8(5-13-6-10-11-12-13)9-4-7-2-1-3-15-7/h6-7H,1-5H2,(H,9,14) |
| InChIKey | OPDCNCVSTBKDAE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |