C18H12FNO2S2 — CID 4514944
3-(4-acetylphenyl)-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4514944) has the molecular formula C18H12FNO2S2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-acetylphenyl)-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4514944 |
| Molecular Formula | C18H12FNO2S2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 3-(4-acetylphenyl)-5-[(2-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(=O)c1ccc(N2C(=O)C(=Cc3ccccc3F)SC2=S)cc1 |
| InChI | InChI=1S/C18H12FNO2S2/c1-11(21)12-6-8-14(9-7-12)20-17(22)16(24-18(20)23)10-13-4-2-3-5-15(13)19/h2-10H,1H3 |
| InChIKey | NHGZQVRTWUSWQB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|