C19H13NO3S2 — CID 4763244
4-[[3-(4-acetylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde (PubChem CID 4763244) has the molecular formula C19H13NO3S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[[3-(4-acetylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde.
| Compound Name | 4-[[3-(4-acetylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde |
|---|---|
| PubChem CID | 4763244 |
| Molecular Formula | C19H13NO3S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 4-[[3-(4-acetylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]benzaldehyde |
| SMILES | CC(=O)c1ccc(N2C(=O)C(=Cc3ccc(C=O)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C19H13NO3S2/c1-12(22)15-6-8-16(9-7-15)20-18(23)17(25-19(20)24)10-13-2-4-14(11-21)5-3-13/h2-11H,1H3 |
| InChIKey | VUUUYPVHBNJGGQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|