C21H17NO3S2 — CID 4515222
4-methyl-3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 4515222) has the molecular formula C21H17NO3S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 4-methyl-3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 4-methyl-3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 4515222 |
| Molecular Formula | C21H17NO3S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-methyl-3-[5-(2-methyl-3-phenylprop-2-enylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | CC(=Cc1ccccc1)C=C1SC(=S)N(c2cc(C(=O)O)ccc2C)C1=O |
| InChI | InChI=1S/C21H17NO3S2/c1-13(10-15-6-4-3-5-7-15)11-18-19(23)22(21(26)27-18)17-12-16(20(24)25)9-8-14(17)2/h3-12H,1-2H3,(H,24,25) |
| InChIKey | PKNRAWFVDITLCN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|