C20H17NO6S2 — CID 6528385
3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid (PubChem CID 6528385) has the molecular formula C20H17NO6S2 and a molecular weight of 431.49 g/mol. Its IUPAC name is 3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid.
| Compound Name | 3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 6528385 |
| Molecular Formula | C20H17NO6S2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 3-[(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(c3cc(C(=O)O)ccc3C)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C20H17NO6S2/c1-10-4-5-12(19(24)25)9-13(10)21-18(23)16(29-20(21)28)8-11-6-14(26-2)17(22)15(7-11)27-3/h4-9,22H,1-3H3,(H,24,25)/b16-8- |
| InChIKey | MNNHHDLYFZPHSD-PXNMLYILSA-N |
| XLogP | 3.82 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|