1,5-diethylpyrazole-4-sulfonyl chloride

C7H11ClN2O2S — CID 45156551

IUPAC1,5-diethylpyrazole-4-sulfonyl chloride
SMILESCCc1c(S(=O)(=O)Cl)cnn1CC
InChIInChI=1S/C7H11ClN2O2S/c1-3-6-7(13(8,11)12)5-9-10(6)4-2/h5H,3-4H2,1-2H3
InChIKeySVEWRNXANPVKSD-UHFFFAOYSA-N
MW222.70 g/mol
LogP1.39
Rot. Bonds3

About 1,5-diethylpyrazole-4-sulfonyl chloride

1,5-diethylpyrazole-4-sulfonyl chloride (PubChem CID 45156551) has the molecular formula C7H11ClN2O2S and a molecular weight of 222.70 g/mol. Its IUPAC name is 1,5-diethylpyrazole-4-sulfonyl chloride.

Molecular Properties

Compound Name1,5-diethylpyrazole-4-sulfonyl chloride
PubChem CID45156551
Molecular FormulaC7H11ClN2O2S
Molecular Weight222.70 g/mol
Exact Mass222.02
IUPAC Name1,5-diethylpyrazole-4-sulfonyl chloride
SMILESCCc1c(S(=O)(=O)Cl)cnn1CC
InChIInChI=1S/C7H11ClN2O2S/c1-3-6-7(13(8,11)12)5-9-10(6)4-2/h5H,3-4H2,1-2H3
InChIKeySVEWRNXANPVKSD-UHFFFAOYSA-N
XLogP1.39
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.70
LogP ≤ 51.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,5-diethylpyrazole-4-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-diethylpyrazole-4-sulfonyl chloride?
The IUPAC name of 1,5-diethylpyrazole-4-sulfonyl chloride (CID 45156551) is 1,5-diethylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 1,5-diethylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 1,5-diethylpyrazole-4-sulfonyl chloride is CCc1c(S(=O)(=O)Cl)cnn1CC.
What is the InChIKey of 1,5-diethylpyrazole-4-sulfonyl chloride?
The InChIKey is SVEWRNXANPVKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2O2S/c1-3-6-7(13(8,11)12)5-9-10(6)4-2/h5H,3-4H2,1-2H3.
What are the key properties of 1,5-diethylpyrazole-4-sulfonyl chloride?
1,5-diethylpyrazole-4-sulfonyl chloride has a molecular weight of 222.70 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diethylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 45156551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).