C12H21ClN2O3S — CID 122171182
5-(butoxymethyl)-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride (PubChem CID 122171182) has the molecular formula C12H21ClN2O3S and a molecular weight of 308.83 g/mol. Its IUPAC name is 5-(butoxymethyl)-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride.
| Compound Name | 5-(butoxymethyl)-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 122171182 |
| Molecular Formula | C12H21ClN2O3S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 5-(butoxymethyl)-1-(2-methylpropyl)pyrazole-4-sulfonyl chloride |
| SMILES | CCCCOCc1c(S(=O)(=O)Cl)cnn1CC(C)C |
| InChI | InChI=1S/C12H21ClN2O3S/c1-4-5-6-18-9-11-12(19(13,16)17)7-14-15(11)8-10(2)3/h7,10H,4-6,8-9H2,1-3H3 |
| InChIKey | KBQUNZOCECFAQT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|