4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride

C13H19ClO4S — CID 90949891

IUPAC4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride
SMILESCC(C)COCCCOc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C13H19ClO4S/c1-11(2)10-17-8-3-9-18-12-4-6-13(7-5-12)19(14,15)16/h4-7,11H,3,8-10H2,1-2H3
InChIKeyIMNZRDLTFAUIJP-UHFFFAOYSA-N
MW306.81 g/mol
LogP3.06
Rot. Bonds8

About 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride

4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride (PubChem CID 90949891) has the molecular formula C13H19ClO4S and a molecular weight of 306.81 g/mol. Its IUPAC name is 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride.

Molecular Properties

Compound Name4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride
PubChem CID90949891
Molecular FormulaC13H19ClO4S
Molecular Weight306.81 g/mol
Exact Mass306.07
IUPAC Name4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride
SMILESCC(C)COCCCOc1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C13H19ClO4S/c1-11(2)10-17-8-3-9-18-12-4-6-13(7-5-12)19(14,15)16/h4-7,11H,3,8-10H2,1-2H3
InChIKeyIMNZRDLTFAUIJP-UHFFFAOYSA-N
XLogP3.06
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.81
LogP ≤ 53.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride?
The IUPAC name of 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride (CID 90949891) is 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride.
What is the SMILES notation for 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride?
The canonical SMILES for 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride is CC(C)COCCCOc1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride?
The InChIKey is IMNZRDLTFAUIJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO4S/c1-11(2)10-17-8-3-9-18-12-4-6-13(7-5-12)19(14,15)16/h4-7,11H,3,8-10H2,1-2H3.
What are the key properties of 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride?
4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride has a molecular weight of 306.81 g/mol, XLogP of 3.06, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2-methylpropoxy)propoxy]benzenesulfonyl chloride is sourced from PubChem (CID 90949891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).