C10H8FNO3 — CID 45157027
[2-(3-fluorophenoxy)-1,3-oxazol-4-yl]methanol (PubChem CID 45157027) has the molecular formula C10H8FNO3 and a molecular weight of 209.18 g/mol. Its IUPAC name is [2-(3-fluorophenoxy)-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-(3-fluorophenoxy)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 45157027 |
| Molecular Formula | C10H8FNO3 |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | [2-(3-fluorophenoxy)-1,3-oxazol-4-yl]methanol |
| SMILES | OCc1coc(Oc2cccc(F)c2)n1 |
| InChI | InChI=1S/C10H8FNO3/c11-7-2-1-3-9(4-7)15-10-12-8(5-13)6-14-10/h1-4,6,13H,5H2 |
| InChIKey | GTGVBENDSRFWFG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |