C11H10FNO3 — CID 107660027
[2-(2-fluoro-3-methylphenoxy)-1,3-oxazol-4-yl]methanol (PubChem CID 107660027) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is [2-(2-fluoro-3-methylphenoxy)-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-(2-fluoro-3-methylphenoxy)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 107660027 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | [2-(2-fluoro-3-methylphenoxy)-1,3-oxazol-4-yl]methanol |
| SMILES | Cc1cccc(Oc2nc(CO)co2)c1F |
| InChI | InChI=1S/C11H10FNO3/c1-7-3-2-4-9(10(7)12)16-11-13-8(5-14)6-15-11/h2-4,6,14H,5H2,1H3 |
| InChIKey | DHDYHJHBBDNXQX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |