C6H10ClF2N — CID 45158910
2,2-difluoro-5-azaspiro[2.4]heptane;hydrochloride (PubChem CID 45158910) has the molecular formula C6H10ClF2N and a molecular weight of 169.60 g/mol. Its IUPAC name is 2,2-difluoro-5-azaspiro[2.4]heptane;hydrochloride.
| Compound Name | 2,2-difluoro-5-azaspiro[2.4]heptane;hydrochloride |
|---|---|
| PubChem CID | 45158910 |
| Molecular Formula | C6H10ClF2N |
| Molecular Weight | 169.60 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 2,2-difluoro-5-azaspiro[2.4]heptane;hydrochloride |
| SMILES | Cl.FC1(F)CC12CCNC2 |
| InChI | InChI=1S/C6H9F2N.ClH/c7-6(8)3-5(6)1-2-9-4-5;/h9H,1-4H2;1H |
| InChIKey | MMTHPQJBBHOCRW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |