C27H35N5OS — CID 45159389
1-(cyclohexylmethyl)-N,N-dimethyl-5-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45159389) has the molecular formula C27H35N5OS and a molecular weight of 477.68 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-N,N-dimethyl-5-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-N,N-dimethyl-5-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45159389 |
| Molecular Formula | C27H35N5OS |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 1-(cyclohexylmethyl)-N,N-dimethyl-5-[(4-phenyl-1,3-thiazol-2-yl)methylamino]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CN(C)C(=O)c1nn(CC2CCCCC2)c2c1CC(NCc1nc(-c3ccccc3)cs1)CC2 |
| InChI | InChI=1S/C27H35N5OS/c1-31(2)27(33)26-22-15-21(13-14-24(22)32(30-26)17-19-9-5-3-6-10-19)28-16-25-29-23(18-34-25)20-11-7-4-8-12-20/h4,7-8,11-12,18-19,21,28H,3,5-6,9-10,13-17H2,1-2H3 |
| InChIKey | LSLLJNRZNZWWPB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |