C21H29N5O2 — CID 45160583
5-(2-acetamidoethylamino)-N-methyl-1-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45160583) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 5-(2-acetamidoethylamino)-N-methyl-1-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 5-(2-acetamidoethylamino)-N-methyl-1-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45160583 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 5-(2-acetamidoethylamino)-N-methyl-1-(2-phenylethyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CNC(=O)c1nn(CCc2ccccc2)c2c1CC(NCCNC(C)=O)CC2 |
| InChI | InChI=1S/C21H29N5O2/c1-15(27)23-11-12-24-17-8-9-19-18(14-17)20(21(28)22-2)25-26(19)13-10-16-6-4-3-5-7-16/h3-7,17,24H,8-14H2,1-2H3,(H,22,28)(H,23,27) |
| InChIKey | IUUKKJJINYNGHQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|