C20H28N4O2 — CID 45164384
1-benzyl-N-ethyl-5-(3-hydroxypropylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45164384) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-benzyl-N-ethyl-5-(3-hydroxypropylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-benzyl-N-ethyl-5-(3-hydroxypropylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45164384 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 1-benzyl-N-ethyl-5-(3-hydroxypropylamino)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCNC(=O)c1nn(Cc2ccccc2)c2c1CC(NCCCO)CC2 |
| InChI | InChI=1S/C20H28N4O2/c1-2-21-20(26)19-17-13-16(22-11-6-12-25)9-10-18(17)24(23-19)14-15-7-4-3-5-8-15/h3-5,7-8,16,22,25H,2,6,9-14H2,1H3,(H,21,26) |
| InChIKey | VGCSUZZNQNLPOR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|