C19H25FN4O2 — CID 45164628
N-[(2-fluorophenyl)methyl]-5-(3-hydroxypropylamino)-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 45164628) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-5-(3-hydroxypropylamino)-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-5-(3-hydroxypropylamino)-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 45164628 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-5-(3-hydroxypropylamino)-1-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCc2ccccc2F)c2c1CCC(NCCCO)C2 |
| InChI | InChI=1S/C19H25FN4O2/c1-24-17-8-7-14(21-9-4-10-25)11-15(17)18(23-24)19(26)22-12-13-5-2-3-6-16(13)20/h2-3,5-6,14,21,25H,4,7-12H2,1H3,(H,22,26) |
| InChIKey | YNARGZICEWPWIM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|