C18H28N4OS — CID 45161871
[5-(prop-2-enylamino)-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-thiomorpholin-4-ylmethanone (PubChem CID 45161871) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is [5-(prop-2-enylamino)-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [5-(prop-2-enylamino)-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 45161871 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [5-(prop-2-enylamino)-1-propyl-4,5,6,7-tetrahydroindazol-3-yl]-thiomorpholin-4-ylmethanone |
| SMILES | C=CCNC1CCc2c(c(C(=O)N3CCSCC3)nn2CCC)C1 |
| InChI | InChI=1S/C18H28N4OS/c1-3-7-19-14-5-6-16-15(13-14)17(20-22(16)8-4-2)18(23)21-9-11-24-12-10-21/h3,14,19H,1,4-13H2,2H3 |
| InChIKey | PUBLGKZJPRRESD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|