C20H33N5O — CID 45162562
[5-(butylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 45162562) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is [5-(butylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [5-(butylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 45162562 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | [5-(butylamino)-1-prop-2-enyl-4,5,6,7-tetrahydroindazol-3-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | C=CCn1nc(C(=O)N2CCN(C)CC2)c2c1CCC(NCCCC)C2 |
| InChI | InChI=1S/C20H33N5O/c1-4-6-9-21-16-7-8-18-17(15-16)19(22-25(18)10-5-2)20(26)24-13-11-23(3)12-14-24/h5,16,21H,2,4,6-15H2,1,3H3 |
| InChIKey | ZNMGDBGAGVVJAJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|