C24H33N5O — CID 26147670
azepan-1-yl-[(5R)-1-prop-2-enyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone (PubChem CID 26147670) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is azepan-1-yl-[(5R)-1-prop-2-enyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone.
| Compound Name | azepan-1-yl-[(5R)-1-prop-2-enyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone |
|---|---|
| PubChem CID | 26147670 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | azepan-1-yl-[(5R)-1-prop-2-enyl-5-(2-pyridin-4-ylethylamino)-4,5,6,7-tetrahydroindazol-3-yl]methanone |
| SMILES | C=CCn1nc(C(=O)N2CCCCCC2)c2c1CC[C@@H](NCCc1ccncc1)C2 |
| InChI | InChI=1S/C24H33N5O/c1-2-15-29-22-8-7-20(26-14-11-19-9-12-25-13-10-19)18-21(22)23(27-29)24(30)28-16-5-3-4-6-17-28/h2,9-10,12-13,20,26H,1,3-8,11,14-18H2/t20-/m1/s1 |
| InChIKey | XUSGFTJAVMRQIG-HXUWFJFHSA-N |
| XLogP | 3.17 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|